C21H28ClN3O6 — CID 159871861
methyl 4-[1-amino-3-[[(2S)-3-methyl-1-[(3R,4S)-4-methyl-2,5-dioxopyrrolidin-3-yl]-1-oxobutan-2-yl]amino]-3-oxopropyl]benzoate;hydrochloride (PubChem CID 159871861) has the molecular formula C21H28ClN3O6 and a molecular weight of 453.92 g/mol. Its IUPAC name is methyl 4-[1-amino-3-[[(2S)-3-methyl-1-[(3R,4S)-4-methyl-2,5-dioxopyrrolidin-3-yl]-1-oxobutan-2-yl]amino]-3-oxopropyl]benzoate;hydrochloride.
| Compound Name | methyl 4-[1-amino-3-[[(2S)-3-methyl-1-[(3R,4S)-4-methyl-2,5-dioxopyrrolidin-3-yl]-1-oxobutan-2-yl]amino]-3-oxopropyl]benzoate;hydrochloride |
|---|---|
| PubChem CID | 159871861 |
| Molecular Formula | C21H28ClN3O6 |
| Molecular Weight | 453.92 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | methyl 4-[1-amino-3-[[(2S)-3-methyl-1-[(3R,4S)-4-methyl-2,5-dioxopyrrolidin-3-yl]-1-oxobutan-2-yl]amino]-3-oxopropyl]benzoate;hydrochloride |
| SMILES | COC(=O)c1ccc(C(N)CC(=O)N[C@H](C(=O)[C@@H]2C(=O)NC(=O)[C@H]2C)C(C)C)cc1.Cl |
| InChI | InChI=1S/C21H27N3O6.ClH/c1-10(2)17(18(26)16-11(3)19(27)24-20(16)28)23-15(25)9-14(22)12-5-7-13(8-6-12)21(29)30-4;/h5-8,10-11,14,16-17H,9,22H2,1-4H3,(H,23,25)(H,24,27,28);1H/t11-,14?,16+,17-;/m0./s1 |
| InChIKey | SLQZGVLBITVJCE-SMTQXDFBSA-N |
| XLogP | 0.90 |
| TPSA | 144.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.92 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|