C30H32N4O6 — CID 58685685
4-methoxy-N-[(1S)-3-[[(2R)-3-methyl-1-[(3R,4S)-4-methyl-2,5-dioxopyrrolidin-3-yl]-1-oxobutan-2-yl]amino]-3-oxo-1-phenylpropyl]quinoline-2-carboxamide (PubChem CID 58685685) has the molecular formula C30H32N4O6 and a molecular weight of 544.61 g/mol. Its IUPAC name is 4-methoxy-N-[(1S)-3-[[(2R)-3-methyl-1-[(3R,4S)-4-methyl-2,5-dioxopyrrolidin-3-yl]-1-oxobutan-2-yl]amino]-3-oxo-1-phenylpropyl]quinoline-2-carboxamide.
| Compound Name | 4-methoxy-N-[(1S)-3-[[(2R)-3-methyl-1-[(3R,4S)-4-methyl-2,5-dioxopyrrolidin-3-yl]-1-oxobutan-2-yl]amino]-3-oxo-1-phenylpropyl]quinoline-2-carboxamide |
|---|---|
| PubChem CID | 58685685 |
| Molecular Formula | C30H32N4O6 |
| Molecular Weight | 544.61 g/mol |
| Exact Mass | 544.23 |
| IUPAC Name | 4-methoxy-N-[(1S)-3-[[(2R)-3-methyl-1-[(3R,4S)-4-methyl-2,5-dioxopyrrolidin-3-yl]-1-oxobutan-2-yl]amino]-3-oxo-1-phenylpropyl]quinoline-2-carboxamide |
| SMILES | COc1cc(C(=O)N[C@@H](CC(=O)N[C@@H](C(=O)[C@@H]2C(=O)NC(=O)[C@H]2C)C(C)C)c2ccccc2)nc2ccccc12 |
| InChI | InChI=1S/C30H32N4O6/c1-16(2)26(27(36)25-17(3)28(37)34-30(25)39)33-24(35)15-21(18-10-6-5-7-11-18)32-29(38)22-14-23(40-4)19-12-8-9-13-20(19)31-22/h5-14,16-17,21,25-26H,15H2,1-4H3,(H,32,38)(H,33,35)(H,34,37,39)/t17-,21-,25+,26+/m0/s1 |
| InChIKey | KWSRRITYQZWWJA-DDUIFEFLSA-N |
| XLogP | 2.72 |
| TPSA | 143.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.61 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|