C27H30N4O5 — CID 59752844
N-[(2S)-3-methyl-1-[(3R,4S)-4-methyl-2,5-dioxopyrrolidin-3-yl]-1-oxobutan-2-yl]-3-[[(E)-3-phenylprop-2-enoyl]amino]-3-pyridin-3-ylpropanamide (PubChem CID 59752844) has the molecular formula C27H30N4O5 and a molecular weight of 490.56 g/mol. Its IUPAC name is N-[(2S)-3-methyl-1-[(3R,4S)-4-methyl-2,5-dioxopyrrolidin-3-yl]-1-oxobutan-2-yl]-3-[[(E)-3-phenylprop-2-enoyl]amino]-3-pyridin-3-ylpropanamide.
| Compound Name | N-[(2S)-3-methyl-1-[(3R,4S)-4-methyl-2,5-dioxopyrrolidin-3-yl]-1-oxobutan-2-yl]-3-[[(E)-3-phenylprop-2-enoyl]amino]-3-pyridin-3-ylpropanamide |
|---|---|
| PubChem CID | 59752844 |
| Molecular Formula | C27H30N4O5 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.22 |
| IUPAC Name | N-[(2S)-3-methyl-1-[(3R,4S)-4-methyl-2,5-dioxopyrrolidin-3-yl]-1-oxobutan-2-yl]-3-[[(E)-3-phenylprop-2-enoyl]amino]-3-pyridin-3-ylpropanamide |
| SMILES | CC(C)[C@H](NC(=O)CC(NC(=O)/C=C/c1ccccc1)c1cccnc1)C(=O)[C@@H]1C(=O)NC(=O)[C@H]1C |
| InChI | InChI=1S/C27H30N4O5/c1-16(2)24(25(34)23-17(3)26(35)31-27(23)36)30-22(33)14-20(19-10-7-13-28-15-19)29-21(32)12-11-18-8-5-4-6-9-18/h4-13,15-17,20,23-24H,14H2,1-3H3,(H,29,32)(H,30,33)(H,31,35,36)/b12-11+/t17-,20?,23+,24-/m0/s1 |
| InChIKey | LRTJFWZJBVURNR-ZXIXYLCCSA-N |
| XLogP | 1.96 |
| TPSA | 134.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|