C27H31N3O6S — CID 68999397
(3S)-N-[(2S)-3-methyl-1-[(3R,4S)-4-methyl-2,5-dioxopyrrolidin-3-yl]-1-oxobutan-2-yl]-3-phenyl-3-(2-phenylethenylsulfonylamino)propanamide (PubChem CID 68999397) has the molecular formula C27H31N3O6S and a molecular weight of 525.63 g/mol. Its IUPAC name is (3S)-N-[(2S)-3-methyl-1-[(3R,4S)-4-methyl-2,5-dioxopyrrolidin-3-yl]-1-oxobutan-2-yl]-3-phenyl-3-(2-phenylethenylsulfonylamino)propanamide.
| Compound Name | (3S)-N-[(2S)-3-methyl-1-[(3R,4S)-4-methyl-2,5-dioxopyrrolidin-3-yl]-1-oxobutan-2-yl]-3-phenyl-3-(2-phenylethenylsulfonylamino)propanamide |
|---|---|
| PubChem CID | 68999397 |
| Molecular Formula | C27H31N3O6S |
| Molecular Weight | 525.63 g/mol |
| Exact Mass | 525.19 |
| IUPAC Name | (3S)-N-[(2S)-3-methyl-1-[(3R,4S)-4-methyl-2,5-dioxopyrrolidin-3-yl]-1-oxobutan-2-yl]-3-phenyl-3-(2-phenylethenylsulfonylamino)propanamide |
| SMILES | CC(C)[C@H](NC(=O)C[C@H](NS(=O)(=O)C=Cc1ccccc1)c1ccccc1)C(=O)[C@@H]1C(=O)NC(=O)[C@H]1C |
| InChI | InChI=1S/C27H31N3O6S/c1-17(2)24(25(32)23-18(3)26(33)29-27(23)34)28-22(31)16-21(20-12-8-5-9-13-20)30-37(35,36)15-14-19-10-6-4-7-11-19/h4-15,17-18,21,23-24,30H,16H2,1-3H3,(H,28,31)(H,29,33,34)/t18-,21-,23+,24-/m0/s1 |
| InChIKey | MSOYIVTZSWGCLT-CJOZULMCSA-N |
| XLogP | 2.33 |
| TPSA | 138.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.63 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|