C31H33N3O5 — CID 11353021
(3S)-N-[(2S)-3-methyl-1-[(3R,4S)-4-methyl-2,5-dioxopyrrolidin-3-yl]-1-oxobutan-2-yl]-3-[(2-naphthalen-2-ylacetyl)amino]-3-phenylpropanamide (PubChem CID 11353021) has the molecular formula C31H33N3O5 and a molecular weight of 527.62 g/mol. Its IUPAC name is (3S)-N-[(2S)-3-methyl-1-[(3R,4S)-4-methyl-2,5-dioxopyrrolidin-3-yl]-1-oxobutan-2-yl]-3-[(2-naphthalen-2-ylacetyl)amino]-3-phenylpropanamide.
| Compound Name | (3S)-N-[(2S)-3-methyl-1-[(3R,4S)-4-methyl-2,5-dioxopyrrolidin-3-yl]-1-oxobutan-2-yl]-3-[(2-naphthalen-2-ylacetyl)amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 11353021 |
| Molecular Formula | C31H33N3O5 |
| Molecular Weight | 527.62 g/mol |
| Exact Mass | 527.24 |
| IUPAC Name | (3S)-N-[(2S)-3-methyl-1-[(3R,4S)-4-methyl-2,5-dioxopyrrolidin-3-yl]-1-oxobutan-2-yl]-3-[(2-naphthalen-2-ylacetyl)amino]-3-phenylpropanamide |
| SMILES | CC(C)[C@H](NC(=O)C[C@H](NC(=O)Cc1ccc2ccccc2c1)c1ccccc1)C(=O)[C@@H]1C(=O)NC(=O)[C@H]1C |
| InChI | InChI=1S/C31H33N3O5/c1-18(2)28(29(37)27-19(3)30(38)34-31(27)39)33-26(36)17-24(22-10-5-4-6-11-22)32-25(35)16-20-13-14-21-9-7-8-12-23(21)15-20/h4-15,18-19,24,27-28H,16-17H2,1-3H3,(H,32,35)(H,33,36)(H,34,38,39)/t19-,24-,27+,28-/m0/s1 |
| InChIKey | CRMJDGUJWUUTNI-GWYWOGJGSA-N |
| XLogP | 3.25 |
| TPSA | 121.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.62 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|