C19H24N4O6 — CID 58685694
(3S)-3-amino-N-[(2S)-3-methyl-1-[(3R,4S)-4-methyl-2,5-dioxopyrrolidin-3-yl]-1-oxobutan-2-yl]-3-(3-nitrophenyl)propanamide (PubChem CID 58685694) has the molecular formula C19H24N4O6 and a molecular weight of 404.42 g/mol. Its IUPAC name is (3S)-3-amino-N-[(2S)-3-methyl-1-[(3R,4S)-4-methyl-2,5-dioxopyrrolidin-3-yl]-1-oxobutan-2-yl]-3-(3-nitrophenyl)propanamide.
| Compound Name | (3S)-3-amino-N-[(2S)-3-methyl-1-[(3R,4S)-4-methyl-2,5-dioxopyrrolidin-3-yl]-1-oxobutan-2-yl]-3-(3-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 58685694 |
| Molecular Formula | C19H24N4O6 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | (3S)-3-amino-N-[(2S)-3-methyl-1-[(3R,4S)-4-methyl-2,5-dioxopyrrolidin-3-yl]-1-oxobutan-2-yl]-3-(3-nitrophenyl)propanamide |
| SMILES | CC(C)[C@H](NC(=O)C[C@H](N)c1cccc([N+](=O)[O-])c1)C(=O)[C@@H]1C(=O)NC(=O)[C@H]1C |
| InChI | InChI=1S/C19H24N4O6/c1-9(2)16(17(25)15-10(3)18(26)22-19(15)27)21-14(24)8-13(20)11-5-4-6-12(7-11)23(28)29/h4-7,9-10,13,15-16H,8,20H2,1-3H3,(H,21,24)(H,22,26,27)/t10-,13-,15+,16-/m0/s1 |
| InChIKey | FOSRWRKPDXIOML-CEFQPYBMSA-N |
| XLogP | 0.60 |
| TPSA | 161.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|