C30H33N3O7 — CID 68939944
(3S)-3-[3-(1,3-benzodioxol-5-yl)prop-2-enoylamino]-N-[(2S)-1-[(3R,4S)-1,4-dimethyl-2,5-dioxopyrrolidin-3-yl]-3-methyl-1-oxobutan-2-yl]-3-phenylpropanamide (PubChem CID 68939944) has the molecular formula C30H33N3O7 and a molecular weight of 547.61 g/mol. Its IUPAC name is (3S)-3-[3-(1,3-benzodioxol-5-yl)prop-2-enoylamino]-N-[(2S)-1-[(3R,4S)-1,4-dimethyl-2,5-dioxopyrrolidin-3-yl]-3-methyl-1-oxobutan-2-yl]-3-phenylpropanamide.
| Compound Name | (3S)-3-[3-(1,3-benzodioxol-5-yl)prop-2-enoylamino]-N-[(2S)-1-[(3R,4S)-1,4-dimethyl-2,5-dioxopyrrolidin-3-yl]-3-methyl-1-oxobutan-2-yl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 68939944 |
| Molecular Formula | C30H33N3O7 |
| Molecular Weight | 547.61 g/mol |
| Exact Mass | 547.23 |
| IUPAC Name | (3S)-3-[3-(1,3-benzodioxol-5-yl)prop-2-enoylamino]-N-[(2S)-1-[(3R,4S)-1,4-dimethyl-2,5-dioxopyrrolidin-3-yl]-3-methyl-1-oxobutan-2-yl]-3-phenylpropanamide |
| SMILES | CC(C)[C@H](NC(=O)C[C@H](NC(=O)C=Cc1ccc2c(c1)OCO2)c1ccccc1)C(=O)[C@@H]1C(=O)N(C)C(=O)[C@H]1C |
| InChI | InChI=1S/C30H33N3O7/c1-17(2)27(28(36)26-18(3)29(37)33(4)30(26)38)32-25(35)15-21(20-8-6-5-7-9-20)31-24(34)13-11-19-10-12-22-23(14-19)40-16-39-22/h5-14,17-18,21,26-27H,15-16H2,1-4H3,(H,31,34)(H,32,35)/t18-,21-,26+,27-/m0/s1 |
| InChIKey | YWZVONGZZMLKOG-LQCLUMCYSA-N |
| XLogP | 2.64 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.61 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|