C17H19F3N4O4 — CID 162325301
tert-butyl 2-(4-pyrimidin-2-ylpyridazin-1-ium-1-yl)propanoate;2,2,2-trifluoroacetate (PubChem CID 162325301) has the molecular formula C17H19F3N4O4 and a molecular weight of 400.36 g/mol. Its IUPAC name is tert-butyl 2-(4-pyrimidin-2-ylpyridazin-1-ium-1-yl)propanoate;2,2,2-trifluoroacetate.
| Compound Name | tert-butyl 2-(4-pyrimidin-2-ylpyridazin-1-ium-1-yl)propanoate;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 162325301 |
| Molecular Formula | C17H19F3N4O4 |
| Molecular Weight | 400.36 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | tert-butyl 2-(4-pyrimidin-2-ylpyridazin-1-ium-1-yl)propanoate;2,2,2-trifluoroacetate |
| SMILES | CC(C(=O)OC(C)(C)C)[n+]1ccc(-c2ncccn2)cn1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C15H19N4O2.C2HF3O2/c1-11(14(20)21-15(2,3)4)19-9-6-12(10-18-19)13-16-7-5-8-17-13;3-2(4,5)1(6)7/h5-11H,1-4H3;(H,6,7)/q+1;/p-1 |
| InChIKey | DKNWNLVNVLCNAB-UHFFFAOYSA-M |
| XLogP | 1.03 |
| TPSA | 108.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.36 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|