C37H37N2NaO7S2 — CID 162329897
sodium 2-[[4-[2-(4-tert-butylphenyl)-2-[5-[3-(4-methylsulfonylphenyl)phenyl]-1,2-oxazol-3-yl]ethyl]benzoyl]amino]ethanesulfonate (PubChem CID 162329897) has the molecular formula C37H37N2NaO7S2 and a molecular weight of 708.83 g/mol. Its IUPAC name is sodium 2-[[4-[2-(4-tert-butylphenyl)-2-[5-[3-(4-methylsulfonylphenyl)phenyl]-1,2-oxazol-3-yl]ethyl]benzoyl]amino]ethanesulfonate.
| Compound Name | sodium 2-[[4-[2-(4-tert-butylphenyl)-2-[5-[3-(4-methylsulfonylphenyl)phenyl]-1,2-oxazol-3-yl]ethyl]benzoyl]amino]ethanesulfonate |
|---|---|
| PubChem CID | 162329897 |
| Molecular Formula | C37H37N2NaO7S2 |
| Molecular Weight | 708.83 g/mol |
| Exact Mass | 708.19 |
| IUPAC Name | sodium 2-[[4-[2-(4-tert-butylphenyl)-2-[5-[3-(4-methylsulfonylphenyl)phenyl]-1,2-oxazol-3-yl]ethyl]benzoyl]amino]ethanesulfonate |
| SMILES | CC(C)(C)c1ccc(C(Cc2ccc(C(=O)NCCS(=O)(=O)[O-])cc2)c2cc(-c3cccc(-c4ccc(S(C)(=O)=O)cc4)c3)on2)cc1.[Na+] |
| InChI | InChI=1S/C37H38N2O7S2.Na/c1-37(2,3)31-16-12-27(13-17-31)33(22-25-8-10-28(11-9-25)36(40)38-20-21-48(43,44)45)34-24-35(46-39-34)30-7-5-6-29(23-30)26-14-18-32(19-15-26)47(4,41)42;/h5-19,23-24,33H,20-22H2,1-4H3,(H,38,40)(H,43,44,45);/q;+1/p-1 |
| InChIKey | YEXRADKDKYITEN-UHFFFAOYSA-M |
| XLogP | 3.36 |
| TPSA | 146.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.83 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|