C25H30N2O4 — CID 162334279
2-cyclopropyl-5-[methyl(2-phenylethyl)amino]-2-phenylpentanenitrile;oxalic acid (PubChem CID 162334279) has the molecular formula C25H30N2O4 and a molecular weight of 422.53 g/mol. Its IUPAC name is 2-cyclopropyl-5-[methyl(2-phenylethyl)amino]-2-phenylpentanenitrile;oxalic acid.
| Compound Name | 2-cyclopropyl-5-[methyl(2-phenylethyl)amino]-2-phenylpentanenitrile;oxalic acid |
|---|---|
| PubChem CID | 162334279 |
| Molecular Formula | C25H30N2O4 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | 2-cyclopropyl-5-[methyl(2-phenylethyl)amino]-2-phenylpentanenitrile;oxalic acid |
| SMILES | CN(CCCC(C#N)(c1ccccc1)C1CC1)CCc1ccccc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C23H28N2.C2H2O4/c1-25(18-15-20-9-4-2-5-10-20)17-8-16-23(19-24,22-13-14-22)21-11-6-3-7-12-21;3-1(4)2(5)6/h2-7,9-12,22H,8,13-18H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | AGJLIUXXBVSMDX-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 101.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|