C24H26ClF5N2O7 — CID 162335462
2,3-dihydroxybutanedioic acid;2-(7-fluoro-1H-indol-3-yl)-N-[[3-(2,2,3,3-tetrafluoropropoxy)phenyl]methyl]ethanamine;hydrochloride (PubChem CID 162335462) has the molecular formula C24H26ClF5N2O7 and a molecular weight of 584.92 g/mol. Its IUPAC name is 2,3-dihydroxybutanedioic acid;2-(7-fluoro-1H-indol-3-yl)-N-[[3-(2,2,3,3-tetrafluoropropoxy)phenyl]methyl]ethanamine;hydrochloride.
| Compound Name | 2,3-dihydroxybutanedioic acid;2-(7-fluoro-1H-indol-3-yl)-N-[[3-(2,2,3,3-tetrafluoropropoxy)phenyl]methyl]ethanamine;hydrochloride |
|---|---|
| PubChem CID | 162335462 |
| Molecular Formula | C24H26ClF5N2O7 |
| Molecular Weight | 584.92 g/mol |
| Exact Mass | 584.13 |
| IUPAC Name | 2,3-dihydroxybutanedioic acid;2-(7-fluoro-1H-indol-3-yl)-N-[[3-(2,2,3,3-tetrafluoropropoxy)phenyl]methyl]ethanamine;hydrochloride |
| SMILES | Cl.Fc1cccc2c(CCNCc3cccc(OCC(F)(F)C(F)F)c3)c[nH]c12.O=C(O)C(O)C(O)C(=O)O |
| InChI | InChI=1S/C20H19F5N2O.C4H6O6.ClH/c21-17-6-2-5-16-14(11-27-18(16)17)7-8-26-10-13-3-1-4-15(9-13)28-12-20(24,25)19(22)23;5-1(3(7)8)2(6)4(9)10;/h1-6,9,11,19,26-27H,7-8,10,12H2;1-2,5-6H,(H,7,8)(H,9,10);1H |
| InChIKey | UVMDSMPSQQOZAX-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 152.11 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.92 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|