C10H17Cl2N3O — CID 162335674
1-piperidin-4-ylpyrrole-3-carboxamide;dihydrochloride (PubChem CID 162335674) has the molecular formula C10H17Cl2N3O and a molecular weight of 266.17 g/mol. Its IUPAC name is 1-piperidin-4-ylpyrrole-3-carboxamide;dihydrochloride.
| Compound Name | 1-piperidin-4-ylpyrrole-3-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 162335674 |
| Molecular Formula | C10H17Cl2N3O |
| Molecular Weight | 266.17 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | 1-piperidin-4-ylpyrrole-3-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.NC(=O)c1ccn(C2CCNCC2)c1 |
| InChI | InChI=1S/C10H15N3O.2ClH/c11-10(14)8-3-6-13(7-8)9-1-4-12-5-2-9;;/h3,6-7,9,12H,1-2,4-5H2,(H2,11,14);2*1H |
| InChIKey | UMQJEELWDWMQGO-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 60.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.17 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |