C9H15N5O — CID 171058867
4-amino-1-piperidin-4-ylpyrazole-3-carboxamide (PubChem CID 171058867) has the molecular formula C9H15N5O and a molecular weight of 209.25 g/mol. Its IUPAC name is 4-amino-1-piperidin-4-ylpyrazole-3-carboxamide.
| Compound Name | 4-amino-1-piperidin-4-ylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 171058867 |
| Molecular Formula | C9H15N5O |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.13 |
| IUPAC Name | 4-amino-1-piperidin-4-ylpyrazole-3-carboxamide |
| SMILES | NC(=O)c1nn(C2CCNCC2)cc1N |
| InChI | InChI=1S/C9H15N5O/c10-7-5-14(13-8(7)9(11)15)6-1-3-12-4-2-6/h5-6,12H,1-4,10H2,(H2,11,15) |
| InChIKey | YJKVXLYSQKVHIJ-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 98.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |