C18H25FN4O3 — CID 174579006
tert-butyl formate;5-fluoro-2-piperidin-4-ylindazole-7-carboxamide (PubChem CID 174579006) has the molecular formula C18H25FN4O3 and a molecular weight of 364.42 g/mol. Its IUPAC name is tert-butyl formate;5-fluoro-2-piperidin-4-ylindazole-7-carboxamide.
| Compound Name | tert-butyl formate;5-fluoro-2-piperidin-4-ylindazole-7-carboxamide |
|---|---|
| PubChem CID | 174579006 |
| Molecular Formula | C18H25FN4O3 |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | tert-butyl formate;5-fluoro-2-piperidin-4-ylindazole-7-carboxamide |
| SMILES | CC(C)(C)OC=O.NC(=O)c1cc(F)cc2cn(C3CCNCC3)nc12 |
| InChI | InChI=1S/C13H15FN4O.C5H10O2/c14-9-5-8-7-18(10-1-3-16-4-2-10)17-12(8)11(6-9)13(15)19;1-5(2,3)7-4-6/h5-7,10,16H,1-4H2,(H2,15,19);4H,1-3H3 |
| InChIKey | RWRMOMLGFPZALJ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|