C17H14N2NaO6S2 — CID 162336330
CID 162336330 (PubChem CID 162336330) has the molecular formula C17H14N2NaO6S2 and a molecular weight of 429.43 g/mol.
| Compound Name | CID 162336330 |
|---|---|
| PubChem CID | 162336330 |
| Molecular Formula | C17H14N2NaO6S2 |
| Molecular Weight | 429.43 g/mol |
| Exact Mass | 429.02 |
| IUPAC Name | — |
| SMILES | Cc1cc2c(cc1CC(=O)c1sccc1S(=O)(=O)Nc1ccon1)OCO2.[Na] |
| InChI | InChI=1S/C17H14N2O6S2.Na/c1-10-6-13-14(24-9-23-13)8-11(10)7-12(20)17-15(3-5-26-17)27(21,22)19-16-2-4-25-18-16;/h2-6,8H,7,9H2,1H3,(H,18,19); |
| InChIKey | UTPQJFGBUAOSBV-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 107.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.43 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |