C18H27ClN6O4S — CID 162337713
N'-[(1S,2R,4S)-4-(dimethylcarbamoyl)-2-[(5-methyl-4,6-dihydropyrrolo[3,4-d][1,3]thiazole-2-carbonyl)amino]cyclohexyl]oxamide;hydrochloride (PubChem CID 162337713) has the molecular formula C18H27ClN6O4S and a molecular weight of 458.97 g/mol. Its IUPAC name is N'-[(1S,2R,4S)-4-(dimethylcarbamoyl)-2-[(5-methyl-4,6-dihydropyrrolo[3,4-d][1,3]thiazole-2-carbonyl)amino]cyclohexyl]oxamide;hydrochloride.
| Compound Name | N'-[(1S,2R,4S)-4-(dimethylcarbamoyl)-2-[(5-methyl-4,6-dihydropyrrolo[3,4-d][1,3]thiazole-2-carbonyl)amino]cyclohexyl]oxamide;hydrochloride |
|---|---|
| PubChem CID | 162337713 |
| Molecular Formula | C18H27ClN6O4S |
| Molecular Weight | 458.97 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | N'-[(1S,2R,4S)-4-(dimethylcarbamoyl)-2-[(5-methyl-4,6-dihydropyrrolo[3,4-d][1,3]thiazole-2-carbonyl)amino]cyclohexyl]oxamide;hydrochloride |
| SMILES | CN1Cc2nc(C(=O)N[C@@H]3C[C@@H](C(=O)N(C)C)CC[C@@H]3NC(=O)C(N)=O)sc2C1.Cl |
| InChI | InChI=1S/C18H26N6O4S.ClH/c1-23(2)18(28)9-4-5-10(20-15(26)14(19)25)11(6-9)21-16(27)17-22-12-7-24(3)8-13(12)29-17;/h9-11H,4-8H2,1-3H3,(H2,19,25)(H,20,26)(H,21,27);1H/t9-,10-,11+;/m0./s1 |
| InChIKey | BFCZTAXFYAXAFA-PBDVDRNWSA-N |
| XLogP | -0.53 |
| TPSA | 137.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.97 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|