C24H29ClN6O4S — CID 59677114
N'-(4-chlorophenyl)-N-[(1S,2R,4S)-4-(dimethylcarbamoyl)-2-[(5-methyl-4,6-dihydropyrrolo[3,4-d][1,3]thiazole-2-carbonyl)amino]cyclohexyl]oxamide (PubChem CID 59677114) has the molecular formula C24H29ClN6O4S and a molecular weight of 533.05 g/mol. Its IUPAC name is N'-(4-chlorophenyl)-N-[(1S,2R,4S)-4-(dimethylcarbamoyl)-2-[(5-methyl-4,6-dihydropyrrolo[3,4-d][1,3]thiazole-2-carbonyl)amino]cyclohexyl]oxamide.
| Compound Name | N'-(4-chlorophenyl)-N-[(1S,2R,4S)-4-(dimethylcarbamoyl)-2-[(5-methyl-4,6-dihydropyrrolo[3,4-d][1,3]thiazole-2-carbonyl)amino]cyclohexyl]oxamide |
|---|---|
| PubChem CID | 59677114 |
| Molecular Formula | C24H29ClN6O4S |
| Molecular Weight | 533.05 g/mol |
| Exact Mass | 532.17 |
| IUPAC Name | N'-(4-chlorophenyl)-N-[(1S,2R,4S)-4-(dimethylcarbamoyl)-2-[(5-methyl-4,6-dihydropyrrolo[3,4-d][1,3]thiazole-2-carbonyl)amino]cyclohexyl]oxamide |
| SMILES | CN1Cc2nc(C(=O)N[C@@H]3C[C@@H](C(=O)N(C)C)CC[C@@H]3NC(=O)C(=O)Nc3ccc(Cl)cc3)sc2C1 |
| InChI | InChI=1S/C24H29ClN6O4S/c1-30(2)24(35)13-4-9-16(27-21(33)20(32)26-15-7-5-14(25)6-8-15)17(10-13)28-22(34)23-29-18-11-31(3)12-19(18)36-23/h5-8,13,16-17H,4,9-12H2,1-3H3,(H,26,32)(H,27,33)(H,28,34)/t13-,16-,17+/m0/s1 |
| InChIKey | RTLLXCRZDIVGLQ-RRQGHBQHSA-N |
| XLogP | 1.85 |
| TPSA | 123.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.05 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|