C21H24ClN5O3S — CID 67056421
N'-(4-chlorophenyl)-N-[(1S,2R)-2-[(5-methyl-4,6-dihydropyrrolo[3,4-d][1,3]thiazole-2-carbonyl)amino]cyclohexyl]oxamide (PubChem CID 67056421) has the molecular formula C21H24ClN5O3S and a molecular weight of 461.98 g/mol. Its IUPAC name is N'-(4-chlorophenyl)-N-[(1S,2R)-2-[(5-methyl-4,6-dihydropyrrolo[3,4-d][1,3]thiazole-2-carbonyl)amino]cyclohexyl]oxamide.
| Compound Name | N'-(4-chlorophenyl)-N-[(1S,2R)-2-[(5-methyl-4,6-dihydropyrrolo[3,4-d][1,3]thiazole-2-carbonyl)amino]cyclohexyl]oxamide |
|---|---|
| PubChem CID | 67056421 |
| Molecular Formula | C21H24ClN5O3S |
| Molecular Weight | 461.98 g/mol |
| Exact Mass | 461.13 |
| IUPAC Name | N'-(4-chlorophenyl)-N-[(1S,2R)-2-[(5-methyl-4,6-dihydropyrrolo[3,4-d][1,3]thiazole-2-carbonyl)amino]cyclohexyl]oxamide |
| SMILES | CN1Cc2nc(C(=O)N[C@@H]3CCCC[C@@H]3NC(=O)C(=O)Nc3ccc(Cl)cc3)sc2C1 |
| InChI | InChI=1S/C21H24ClN5O3S/c1-27-10-16-17(11-27)31-21(26-16)20(30)25-15-5-3-2-4-14(15)24-19(29)18(28)23-13-8-6-12(22)7-9-13/h6-9,14-15H,2-5,10-11H2,1H3,(H,23,28)(H,24,29)(H,25,30)/t14-,15+/m0/s1 |
| InChIKey | CMQQXKHGKAIALV-LSDHHAIUSA-N |
| XLogP | 2.54 |
| TPSA | 103.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.98 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|