C26H32ClFN6O4S — CID 58208872
N'-(4-chloro-3-fluorophenyl)-N-[(1S,2R,4S)-4-[ethyl(methyl)carbamoyl]-2-[(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)amino]cyclohexyl]oxamide (PubChem CID 58208872) has the molecular formula C26H32ClFN6O4S and a molecular weight of 579.10 g/mol. Its IUPAC name is N'-(4-chloro-3-fluorophenyl)-N-[(1S,2R,4S)-4-[ethyl(methyl)carbamoyl]-2-[(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)amino]cyclohexyl]oxamide.
| Compound Name | N'-(4-chloro-3-fluorophenyl)-N-[(1S,2R,4S)-4-[ethyl(methyl)carbamoyl]-2-[(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)amino]cyclohexyl]oxamide |
|---|---|
| PubChem CID | 58208872 |
| Molecular Formula | C26H32ClFN6O4S |
| Molecular Weight | 579.10 g/mol |
| Exact Mass | 578.19 |
| IUPAC Name | N'-(4-chloro-3-fluorophenyl)-N-[(1S,2R,4S)-4-[ethyl(methyl)carbamoyl]-2-[(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)amino]cyclohexyl]oxamide |
| SMILES | CCN(C)C(=O)[C@H]1CC[C@H](NC(=O)C(=O)Nc2ccc(Cl)c(F)c2)[C@H](NC(=O)c2nc3c(s2)CN(C)CC3)C1 |
| InChI | InChI=1S/C26H32ClFN6O4S/c1-4-34(3)26(38)14-5-8-18(30-23(36)22(35)29-15-6-7-16(27)17(28)12-15)20(11-14)31-24(37)25-32-19-9-10-33(2)13-21(19)39-25/h6-7,12,14,18,20H,4-5,8-11,13H2,1-3H3,(H,29,35)(H,30,36)(H,31,37)/t14-,18-,20+/m0/s1 |
| InChIKey | PEZYRIWNBXFIHS-ADLFWFRXSA-N |
| XLogP | 2.42 |
| TPSA | 123.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.10 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|