C18H26N6O3S2 — CID 150823831
N'-[(1S,2R,4S)-4-(methylcarbamothioyl)-2-[(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)amino]cyclohexyl]oxamide (PubChem CID 150823831) has the molecular formula C18H26N6O3S2 and a molecular weight of 438.58 g/mol. Its IUPAC name is N'-[(1S,2R,4S)-4-(methylcarbamothioyl)-2-[(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)amino]cyclohexyl]oxamide.
| Compound Name | N'-[(1S,2R,4S)-4-(methylcarbamothioyl)-2-[(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)amino]cyclohexyl]oxamide |
|---|---|
| PubChem CID | 150823831 |
| Molecular Formula | C18H26N6O3S2 |
| Molecular Weight | 438.58 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | N'-[(1S,2R,4S)-4-(methylcarbamothioyl)-2-[(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)amino]cyclohexyl]oxamide |
| SMILES | CNC(=S)[C@H]1CC[C@H](NC(=O)C(N)=O)[C@H](NC(=O)c2nc3c(s2)CN(C)CC3)C1 |
| InChI | InChI=1S/C18H26N6O3S2/c1-20-17(28)9-3-4-10(21-15(26)14(19)25)12(7-9)22-16(27)18-23-11-5-6-24(2)8-13(11)29-18/h9-10,12H,3-8H2,1-2H3,(H2,19,25)(H,20,28)(H,21,26)(H,22,27)/t9-,10-,12+/m0/s1 |
| InChIKey | KKMLKTRVCCVOEN-JBLDHEPKSA-N |
| XLogP | -0.45 |
| TPSA | 129.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.58 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|