C19H25ClN6O3S2 — CID 172769528
N'-[(1S,2R,4R)-2-[(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)amino]-4-(1,3-thiazol-2-yl)cyclohexyl]oxamide;hydrochloride (PubChem CID 172769528) has the molecular formula C19H25ClN6O3S2 and a molecular weight of 485.04 g/mol. Its IUPAC name is N'-[(1S,2R,4R)-2-[(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)amino]-4-(1,3-thiazol-2-yl)cyclohexyl]oxamide;hydrochloride.
| Compound Name | N'-[(1S,2R,4R)-2-[(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)amino]-4-(1,3-thiazol-2-yl)cyclohexyl]oxamide;hydrochloride |
|---|---|
| PubChem CID | 172769528 |
| Molecular Formula | C19H25ClN6O3S2 |
| Molecular Weight | 485.04 g/mol |
| Exact Mass | 484.11 |
| IUPAC Name | N'-[(1S,2R,4R)-2-[(5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)amino]-4-(1,3-thiazol-2-yl)cyclohexyl]oxamide;hydrochloride |
| SMILES | CN1CCc2nc(C(=O)N[C@@H]3C[C@H](c4nccs4)CC[C@@H]3NC(=O)C(N)=O)sc2C1.Cl |
| InChI | InChI=1S/C19H24N6O3S2.ClH/c1-25-6-4-12-14(9-25)30-19(24-12)17(28)23-13-8-10(18-21-5-7-29-18)2-3-11(13)22-16(27)15(20)26;/h5,7,10-11,13H,2-4,6,8-9H2,1H3,(H2,20,26)(H,22,27)(H,23,28);1H/t10-,11+,13-;/m1./s1 |
| InChIKey | MTNCRAIRJMWFOQ-GYBQEXSMSA-N |
| XLogP | 1.05 |
| TPSA | 130.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.04 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|