C26H28ClFN6O3S — CID 66967045
N-[(1R,2S,5S)-2-[[3-(4-chlorophenyl)-2-fluoroprop-2-enoyl]amino]-5-(5-methyl-1,3,4-oxadiazol-2-yl)cyclohexyl]-5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide (PubChem CID 66967045) has the molecular formula C26H28ClFN6O3S and a molecular weight of 559.07 g/mol. Its IUPAC name is N-[(1R,2S,5S)-2-[[3-(4-chlorophenyl)-2-fluoroprop-2-enoyl]amino]-5-(5-methyl-1,3,4-oxadiazol-2-yl)cyclohexyl]-5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide.
| Compound Name | N-[(1R,2S,5S)-2-[[3-(4-chlorophenyl)-2-fluoroprop-2-enoyl]amino]-5-(5-methyl-1,3,4-oxadiazol-2-yl)cyclohexyl]-5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 66967045 |
| Molecular Formula | C26H28ClFN6O3S |
| Molecular Weight | 559.07 g/mol |
| Exact Mass | 558.16 |
| IUPAC Name | N-[(1R,2S,5S)-2-[[3-(4-chlorophenyl)-2-fluoroprop-2-enoyl]amino]-5-(5-methyl-1,3,4-oxadiazol-2-yl)cyclohexyl]-5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide |
| SMILES | Cc1nnc([C@H]2CC[C@H](NC(=O)C(F)=Cc3ccc(Cl)cc3)[C@H](NC(=O)c3nc4c(s3)CN(C)CC4)C2)o1 |
| InChI | InChI=1S/C26H28ClFN6O3S/c1-14-32-33-25(37-14)16-5-8-19(29-23(35)18(28)11-15-3-6-17(27)7-4-15)21(12-16)30-24(36)26-31-20-9-10-34(2)13-22(20)38-26/h3-4,6-7,11,16,19,21H,5,8-10,12-13H2,1-2H3,(H,29,35)(H,30,36)/t16-,19-,21+/m0/s1 |
| InChIKey | OZNIHQVEANPUFJ-NBHGPNQESA-N |
| XLogP | 4.04 |
| TPSA | 113.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.07 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|