C29H46N7O4+ — CID 162338850
[2-[[4-[[2-[3-(diethylamino)propylamino]-6,7-dimethoxyquinazolin-4-yl]amino]piperidin-1-yl]methyl]phenyl]-hydroxyazanium;hydrate (PubChem CID 162338850) has the molecular formula C29H46N7O4+ and a molecular weight of 556.73 g/mol. Its IUPAC name is [2-[[4-[[2-[3-(diethylamino)propylamino]-6,7-dimethoxyquinazolin-4-yl]amino]piperidin-1-yl]methyl]phenyl]-hydroxyazanium;hydrate.
| Compound Name | [2-[[4-[[2-[3-(diethylamino)propylamino]-6,7-dimethoxyquinazolin-4-yl]amino]piperidin-1-yl]methyl]phenyl]-hydroxyazanium;hydrate |
|---|---|
| PubChem CID | 162338850 |
| Molecular Formula | C29H46N7O4+ |
| Molecular Weight | 556.73 g/mol |
| Exact Mass | 556.36 |
| IUPAC Name | [2-[[4-[[2-[3-(diethylamino)propylamino]-6,7-dimethoxyquinazolin-4-yl]amino]piperidin-1-yl]methyl]phenyl]-hydroxyazanium;hydrate |
| SMILES | CCN(CC)CCCNc1nc(NC2CCN(Cc3ccccc3[NH2+]O)CC2)c2cc(OC)c(OC)cc2n1.O |
| InChI | InChI=1S/C29H43N7O3.H2O/c1-5-35(6-2)15-9-14-30-29-32-25-19-27(39-4)26(38-3)18-23(25)28(33-29)31-22-12-16-36(17-13-22)20-21-10-7-8-11-24(21)34-37;/h7-8,10-11,18-19,22,34,37H,5-6,9,12-17,20H2,1-4H3,(H2,30,31,32,33);1H2/p+1 |
| InChIKey | BVUNAGANZHDSQP-UHFFFAOYSA-O |
| XLogP | 2.63 |
| TPSA | 143.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.73 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|