C29H37N7 — CID 58006247
2-N-[3-(dimethylamino)propyl]-4-N-[1-[(2-pyrrol-1-ylphenyl)methyl]piperidin-4-yl]quinazoline-2,4-diamine (PubChem CID 58006247) has the molecular formula C29H37N7 and a molecular weight of 483.66 g/mol. Its IUPAC name is 2-N-[3-(dimethylamino)propyl]-4-N-[1-[(2-pyrrol-1-ylphenyl)methyl]piperidin-4-yl]quinazoline-2,4-diamine.
| Compound Name | 2-N-[3-(dimethylamino)propyl]-4-N-[1-[(2-pyrrol-1-ylphenyl)methyl]piperidin-4-yl]quinazoline-2,4-diamine |
|---|---|
| PubChem CID | 58006247 |
| Molecular Formula | C29H37N7 |
| Molecular Weight | 483.66 g/mol |
| Exact Mass | 483.31 |
| IUPAC Name | 2-N-[3-(dimethylamino)propyl]-4-N-[1-[(2-pyrrol-1-ylphenyl)methyl]piperidin-4-yl]quinazoline-2,4-diamine |
| SMILES | CN(C)CCCNc1nc(NC2CCN(Cc3ccccc3-n3cccc3)CC2)c2ccccc2n1 |
| InChI | InChI=1S/C29H37N7/c1-34(2)17-9-16-30-29-32-26-12-5-4-11-25(26)28(33-29)31-24-14-20-35(21-15-24)22-23-10-3-6-13-27(23)36-18-7-8-19-36/h3-8,10-13,18-19,24H,9,14-17,20-22H2,1-2H3,(H2,30,31,32,33) |
| InChIKey | RXKUVJCHUOEHNR-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 61.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.66 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|