C26H26IN5O — CID 162343380
[6-[2-[(6-iodoquinazolin-4-yl)amino]ethyl]naphthalen-2-yl]-(4-methylpiperazin-1-yl)methanone (PubChem CID 162343380) has the molecular formula C26H26IN5O and a molecular weight of 551.43 g/mol. Its IUPAC name is [6-[2-[(6-iodoquinazolin-4-yl)amino]ethyl]naphthalen-2-yl]-(4-methylpiperazin-1-yl)methanone.
| Compound Name | [6-[2-[(6-iodoquinazolin-4-yl)amino]ethyl]naphthalen-2-yl]-(4-methylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 162343380 |
| Molecular Formula | C26H26IN5O |
| Molecular Weight | 551.43 g/mol |
| Exact Mass | 551.12 |
| IUPAC Name | [6-[2-[(6-iodoquinazolin-4-yl)amino]ethyl]naphthalen-2-yl]-(4-methylpiperazin-1-yl)methanone |
| SMILES | CN1CCN(C(=O)c2ccc3cc(CCNc4ncnc5ccc(I)cc45)ccc3c2)CC1 |
| InChI | InChI=1S/C26H26IN5O/c1-31-10-12-32(13-11-31)26(33)21-5-4-19-14-18(2-3-20(19)15-21)8-9-28-25-23-16-22(27)6-7-24(23)29-17-30-25/h2-7,14-17H,8-13H2,1H3,(H,28,29,30) |
| InChIKey | WOAWCMRNIRJMIL-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.43 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|