C27H27IN4O — CID 164711582
[6-[2-[(6-iodoquinolin-4-yl)amino]ethyl]naphthalen-2-yl]-(4-methylpiperazin-1-yl)methanone (PubChem CID 164711582) has the molecular formula C27H27IN4O and a molecular weight of 550.44 g/mol. Its IUPAC name is [6-[2-[(6-iodoquinolin-4-yl)amino]ethyl]naphthalen-2-yl]-(4-methylpiperazin-1-yl)methanone.
| Compound Name | [6-[2-[(6-iodoquinolin-4-yl)amino]ethyl]naphthalen-2-yl]-(4-methylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 164711582 |
| Molecular Formula | C27H27IN4O |
| Molecular Weight | 550.44 g/mol |
| Exact Mass | 550.12 |
| IUPAC Name | [6-[2-[(6-iodoquinolin-4-yl)amino]ethyl]naphthalen-2-yl]-(4-methylpiperazin-1-yl)methanone |
| SMILES | CN1CCN(C(=O)c2ccc3cc(CCNc4ccnc5ccc(I)cc45)ccc3c2)CC1 |
| InChI | InChI=1S/C27H27IN4O/c1-31-12-14-32(15-13-31)27(33)22-5-4-20-16-19(2-3-21(20)17-22)8-10-29-26-9-11-30-25-7-6-23(28)18-24(25)26/h2-7,9,11,16-18H,8,10,12-15H2,1H3,(H,29,30) |
| InChIKey | KMAYEONWEPQYGP-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.44 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|