C32H33N5O3 — CID 153455087
tert-butyl 4-[6-[2-[(6-isocyanoquinolin-4-yl)amino]ethyl]naphthalene-2-carbonyl]piperazine-1-carboxylate (PubChem CID 153455087) has the molecular formula C32H33N5O3 and a molecular weight of 535.65 g/mol. Its IUPAC name is tert-butyl 4-[6-[2-[(6-isocyanoquinolin-4-yl)amino]ethyl]naphthalene-2-carbonyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[6-[2-[(6-isocyanoquinolin-4-yl)amino]ethyl]naphthalene-2-carbonyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 153455087 |
| Molecular Formula | C32H33N5O3 |
| Molecular Weight | 535.65 g/mol |
| Exact Mass | 535.26 |
| IUPAC Name | tert-butyl 4-[6-[2-[(6-isocyanoquinolin-4-yl)amino]ethyl]naphthalene-2-carbonyl]piperazine-1-carboxylate |
| SMILES | [C-]#[N+]c1ccc2nccc(NCCc3ccc4cc(C(=O)N5CCN(C(=O)OC(C)(C)C)CC5)ccc4c3)c2c1 |
| InChI | InChI=1S/C32H33N5O3/c1-32(2,3)40-31(39)37-17-15-36(16-18-37)30(38)25-8-7-23-19-22(5-6-24(23)20-25)11-13-34-29-12-14-35-28-10-9-26(33-4)21-27(28)29/h5-10,12,14,19-21H,11,13,15-18H2,1-3H3,(H,34,35) |
| InChIKey | FLSUYAATRUCZPZ-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 79.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.65 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|