C27H26N6O — CID 164711599
[6-[2-[(6-isocyano-1,8-naphthyridin-4-yl)amino]ethyl]naphthalen-2-yl]-(4-methylpiperazin-1-yl)methanone (PubChem CID 164711599) has the molecular formula C27H26N6O and a molecular weight of 450.55 g/mol. Its IUPAC name is [6-[2-[(6-isocyano-1,8-naphthyridin-4-yl)amino]ethyl]naphthalen-2-yl]-(4-methylpiperazin-1-yl)methanone.
| Compound Name | [6-[2-[(6-isocyano-1,8-naphthyridin-4-yl)amino]ethyl]naphthalen-2-yl]-(4-methylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 164711599 |
| Molecular Formula | C27H26N6O |
| Molecular Weight | 450.55 g/mol |
| Exact Mass | 450.22 |
| IUPAC Name | [6-[2-[(6-isocyano-1,8-naphthyridin-4-yl)amino]ethyl]naphthalen-2-yl]-(4-methylpiperazin-1-yl)methanone |
| SMILES | [C-]#[N+]c1cnc2nccc(NCCc3ccc4cc(C(=O)N5CCN(C)CC5)ccc4c3)c2c1 |
| InChI | InChI=1S/C27H26N6O/c1-28-23-17-24-25(8-10-30-26(24)31-18-23)29-9-7-19-3-4-21-16-22(6-5-20(21)15-19)27(34)33-13-11-32(2)12-14-33/h3-6,8,10,15-18H,7,9,11-14H2,2H3,(H,29,30,31) |
| InChIKey | OMNCWKZOSYQUGF-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.55 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|