C24H41NO3 — CID 162344953
(2S,3S)-3-methyl-2-[[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]amino]pentanoic acid (PubChem CID 162344953) has the molecular formula C24H41NO3 and a molecular weight of 391.60 g/mol. Its IUPAC name is (2S,3S)-3-methyl-2-[[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]amino]pentanoic acid.
| Compound Name | (2S,3S)-3-methyl-2-[[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 162344953 |
| Molecular Formula | C24H41NO3 |
| Molecular Weight | 391.60 g/mol |
| Exact Mass | 391.31 |
| IUPAC Name | (2S,3S)-3-methyl-2-[[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]amino]pentanoic acid |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCC(=O)N[C@H](C(=O)O)[C@@H](C)CC |
| InChI | InChI=1S/C24H41NO3/c1-4-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-22(26)25-23(24(27)28)21(3)5-2/h6-7,9-10,12-13,21,23H,4-5,8,11,14-20H2,1-3H3,(H,25,26)(H,27,28)/b7-6-,10-9-,13-12-/t21-,23-/m0/s1 |
| InChIKey | PSJVHVYJGAEBOS-FGUCHMMGSA-N |
| XLogP | 6.19 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.60 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|