C22H24N2O10 — CID 162345187
(4S,4aS,5aR,6S,12aS)-4-(dimethylamino)-2,6,10,11a,12a-pentahydroxy-6-methyl-1,3,11,12-tetraoxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide (PubChem CID 162345187) has the molecular formula C22H24N2O10 and a molecular weight of 476.44 g/mol. Its IUPAC name is (4S,4aS,5aR,6S,12aS)-4-(dimethylamino)-2,6,10,11a,12a-pentahydroxy-6-methyl-1,3,11,12-tetraoxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,6S,12aS)-4-(dimethylamino)-2,6,10,11a,12a-pentahydroxy-6-methyl-1,3,11,12-tetraoxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 162345187 |
| Molecular Formula | C22H24N2O10 |
| Molecular Weight | 476.44 g/mol |
| Exact Mass | 476.14 |
| IUPAC Name | (4S,4aS,5aR,6S,12aS)-4-(dimethylamino)-2,6,10,11a,12a-pentahydroxy-6-methyl-1,3,11,12-tetraoxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide |
| SMILES | CN(C)[C@@H]1C(=O)C(O)(C(N)=O)C(=O)[C@@]2(O)C(=O)C3(O)C(=O)c4c(O)cccc4[C@@](C)(O)[C@H]3C[C@@H]12 |
| InChI | InChI=1S/C22H24N2O10/c1-19(31)8-5-4-6-10(25)12(8)14(26)21(33)11(19)7-9-13(24(2)3)15(27)22(34,18(23)30)17(29)20(9,32)16(21)28/h4-6,9,11,13,25,31-34H,7H2,1-3H3,(H2,23,30)/t9-,11+,13-,19+,20-,21?,22?/m0/s1 |
| InChIKey | HSZPKULWYMQOIO-UCDVEERMSA-N |
| XLogP | -3.24 |
| TPSA | 215.76 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.44 |
| LogP ≤ 5 | -3.24 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|