C22H24N2O10 — CID 162345068
(4S,4aS,6S,8aS)-4-(dimethylamino)-2,7,8,8a-tetrahydroxy-6-[(1R)-4-hydroxy-1-methyl-3-oxo-2-benzofuran-1-yl]-1,3-dioxo-4,4a,5,6-tetrahydronaphthalene-2-carboxamide (PubChem CID 162345068) has the molecular formula C22H24N2O10 and a molecular weight of 476.44 g/mol. Its IUPAC name is (4S,4aS,6S,8aS)-4-(dimethylamino)-2,7,8,8a-tetrahydroxy-6-[(1R)-4-hydroxy-1-methyl-3-oxo-2-benzofuran-1-yl]-1,3-dioxo-4,4a,5,6-tetrahydronaphthalene-2-carboxamide.
| Compound Name | (4S,4aS,6S,8aS)-4-(dimethylamino)-2,7,8,8a-tetrahydroxy-6-[(1R)-4-hydroxy-1-methyl-3-oxo-2-benzofuran-1-yl]-1,3-dioxo-4,4a,5,6-tetrahydronaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 162345068 |
| Molecular Formula | C22H24N2O10 |
| Molecular Weight | 476.44 g/mol |
| Exact Mass | 476.14 |
| IUPAC Name | (4S,4aS,6S,8aS)-4-(dimethylamino)-2,7,8,8a-tetrahydroxy-6-[(1R)-4-hydroxy-1-methyl-3-oxo-2-benzofuran-1-yl]-1,3-dioxo-4,4a,5,6-tetrahydronaphthalene-2-carboxamide |
| SMILES | CN(C)[C@@H]1C(=O)C(O)(C(N)=O)C(=O)[C@@]2(O)C(O)=C(O)[C@@H]([C@@]3(C)OC(=O)c4c(O)cccc43)C[C@@H]12 |
| InChI | InChI=1S/C22H24N2O10/c1-20(8-5-4-6-11(25)12(8)17(29)34-20)10-7-9-13(24(2)3)15(27)22(33,19(23)31)18(30)21(9,32)16(28)14(10)26/h4-6,9-10,13,25-26,28,32-33H,7H2,1-3H3,(H2,23,31)/t9-,10-,13-,20-,21-,22?/m0/s1 |
| InChIKey | CNBDKTYDTJLNCP-KMMNVJATSA-N |
| XLogP | -1.23 |
| TPSA | 207.92 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.44 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|