C16H19F3O4 — CID 162346961
2-[2-formyl-5-(trifluoromethyl)phenoxy]-2,4,4-trimethylpentanoic acid (PubChem CID 162346961) has the molecular formula C16H19F3O4 and a molecular weight of 332.32 g/mol. Its IUPAC name is 2-[2-formyl-5-(trifluoromethyl)phenoxy]-2,4,4-trimethylpentanoic acid.
| Compound Name | 2-[2-formyl-5-(trifluoromethyl)phenoxy]-2,4,4-trimethylpentanoic acid |
|---|---|
| PubChem CID | 162346961 |
| Molecular Formula | C16H19F3O4 |
| Molecular Weight | 332.32 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | 2-[2-formyl-5-(trifluoromethyl)phenoxy]-2,4,4-trimethylpentanoic acid |
| SMILES | CC(C)(C)CC(C)(Oc1cc(C(F)(F)F)ccc1C=O)C(=O)O |
| InChI | InChI=1S/C16H19F3O4/c1-14(2,3)9-15(4,13(21)22)23-12-7-11(16(17,18)19)6-5-10(12)8-20/h5-8H,9H2,1-4H3,(H,21,22) |
| InChIKey | VTDWATGVVNKBRL-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.32 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|