C17H13Cl2F3O4 — CID 159661121
2-(2-chlorophenoxy)-3-[2-chloro-4-(trifluoromethyl)phenoxy]-2-methylpropanoic acid (PubChem CID 159661121) has the molecular formula C17H13Cl2F3O4 and a molecular weight of 409.19 g/mol. Its IUPAC name is 2-(2-chlorophenoxy)-3-[2-chloro-4-(trifluoromethyl)phenoxy]-2-methylpropanoic acid.
| Compound Name | 2-(2-chlorophenoxy)-3-[2-chloro-4-(trifluoromethyl)phenoxy]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 159661121 |
| Molecular Formula | C17H13Cl2F3O4 |
| Molecular Weight | 409.19 g/mol |
| Exact Mass | 408.01 |
| IUPAC Name | 2-(2-chlorophenoxy)-3-[2-chloro-4-(trifluoromethyl)phenoxy]-2-methylpropanoic acid |
| SMILES | CC(COc1ccc(C(F)(F)F)cc1Cl)(Oc1ccccc1Cl)C(=O)O |
| InChI | InChI=1S/C17H13Cl2F3O4/c1-16(15(23)24,26-14-5-3-2-4-11(14)18)9-25-13-7-6-10(8-12(13)19)17(20,21)22/h2-8H,9H2,1H3,(H,23,24) |
| InChIKey | MSUWOTRKXWNREJ-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.19 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |