C19H16ClF3N2O2 — CID 10135400
3-(2-chlorophenoxy)-2-cyano-2-methyl-N-[[4-(trifluoromethyl)phenyl]methyl]propanamide (PubChem CID 10135400) has the molecular formula C19H16ClF3N2O2 and a molecular weight of 396.80 g/mol. Its IUPAC name is 3-(2-chlorophenoxy)-2-cyano-2-methyl-N-[[4-(trifluoromethyl)phenyl]methyl]propanamide.
| Compound Name | 3-(2-chlorophenoxy)-2-cyano-2-methyl-N-[[4-(trifluoromethyl)phenyl]methyl]propanamide |
|---|---|
| PubChem CID | 10135400 |
| Molecular Formula | C19H16ClF3N2O2 |
| Molecular Weight | 396.80 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | 3-(2-chlorophenoxy)-2-cyano-2-methyl-N-[[4-(trifluoromethyl)phenyl]methyl]propanamide |
| SMILES | CC(C#N)(COc1ccccc1Cl)C(=O)NCc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H16ClF3N2O2/c1-18(11-24,12-27-16-5-3-2-4-15(16)20)17(26)25-10-13-6-8-14(9-7-13)19(21,22)23/h2-9H,10,12H2,1H3,(H,25,26) |
| InChIKey | MHYAJSXNHGAHSR-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.80 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |