C6H7F7O — CID 162348184
1,1,1,2-tetrafluoro-4-(trifluoromethoxy)pentane (PubChem CID 162348184) has the molecular formula C6H7F7O and a molecular weight of 228.11 g/mol. Its IUPAC name is 1,1,1,2-tetrafluoro-4-(trifluoromethoxy)pentane.
| Compound Name | 1,1,1,2-tetrafluoro-4-(trifluoromethoxy)pentane |
|---|---|
| PubChem CID | 162348184 |
| Molecular Formula | C6H7F7O |
| Molecular Weight | 228.11 g/mol |
| Exact Mass | 228.04 |
| IUPAC Name | 1,1,1,2-tetrafluoro-4-(trifluoromethoxy)pentane |
| SMILES | CC(CC(F)C(F)(F)F)OC(F)(F)F |
| InChI | InChI=1S/C6H7F7O/c1-3(14-6(11,12)13)2-4(7)5(8,9)10/h3-4H,2H2,1H3 |
| InChIKey | WKDBVKGHHBGIDK-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.11 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |