C7H8F8O2 — CID 91723921
1,1,1,2,2,5,5,5-octafluoro-3,4-dimethoxypentane (PubChem CID 91723921) has the molecular formula C7H8F8O2 and a molecular weight of 276.12 g/mol. Its IUPAC name is 1,1,1,2,2,5,5,5-octafluoro-3,4-dimethoxypentane.
| Compound Name | 1,1,1,2,2,5,5,5-octafluoro-3,4-dimethoxypentane |
|---|---|
| PubChem CID | 91723921 |
| Molecular Formula | C7H8F8O2 |
| Molecular Weight | 276.12 g/mol |
| Exact Mass | 276.04 |
| IUPAC Name | 1,1,1,2,2,5,5,5-octafluoro-3,4-dimethoxypentane |
| SMILES | COC(C(OC)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H8F8O2/c1-16-3(4(17-2)6(10,11)12)5(8,9)7(13,14)15/h3-4H,1-2H3 |
| InChIKey | GJBVCHYTZWFTPX-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.12 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|