C14H13Br2N — CID 162350796
2-(1,1-dibromo-2-phenylethyl)aniline (PubChem CID 162350796) has the molecular formula C14H13Br2N and a molecular weight of 355.07 g/mol. Its IUPAC name is 2-(1,1-dibromo-2-phenylethyl)aniline.
| Compound Name | 2-(1,1-dibromo-2-phenylethyl)aniline |
|---|---|
| PubChem CID | 162350796 |
| Molecular Formula | C14H13Br2N |
| Molecular Weight | 355.07 g/mol |
| Exact Mass | 352.94 |
| IUPAC Name | 2-(1,1-dibromo-2-phenylethyl)aniline |
| SMILES | Nc1ccccc1C(Br)(Br)Cc1ccccc1 |
| InChI | InChI=1S/C14H13Br2N/c15-14(16,10-11-6-2-1-3-7-11)12-8-4-5-9-13(12)17/h1-9H,10,17H2 |
| InChIKey | JCCFFBUODQRFIR-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.07 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|