C13H18FN5O2 — CID 162356455
(5-fluoro-2-piperazin-1-ylpyrimidin-4-yl)-(3-methoxyazetidin-1-yl)methanone (PubChem CID 162356455) has the molecular formula C13H18FN5O2 and a molecular weight of 295.32 g/mol. Its IUPAC name is (5-fluoro-2-piperazin-1-ylpyrimidin-4-yl)-(3-methoxyazetidin-1-yl)methanone.
| Compound Name | (5-fluoro-2-piperazin-1-ylpyrimidin-4-yl)-(3-methoxyazetidin-1-yl)methanone |
|---|---|
| PubChem CID | 162356455 |
| Molecular Formula | C13H18FN5O2 |
| Molecular Weight | 295.32 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | (5-fluoro-2-piperazin-1-ylpyrimidin-4-yl)-(3-methoxyazetidin-1-yl)methanone |
| SMILES | COC1CN(C(=O)c2nc(N3CCNCC3)ncc2F)C1 |
| InChI | InChI=1S/C13H18FN5O2/c1-21-9-7-19(8-9)12(20)11-10(14)6-16-13(17-11)18-4-2-15-3-5-18/h6,9,15H,2-5,7-8H2,1H3 |
| InChIKey | BLPGIYSPFYFBTO-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.32 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |