C16H23FN6O2 — CID 175378390
4-[4-[3-(dimethylamino)pyrrolidine-1-carbonyl]-5-fluoropyrimidin-2-yl]piperazine-1-carbaldehyde (PubChem CID 175378390) has the molecular formula C16H23FN6O2 and a molecular weight of 350.40 g/mol. Its IUPAC name is 4-[4-[3-(dimethylamino)pyrrolidine-1-carbonyl]-5-fluoropyrimidin-2-yl]piperazine-1-carbaldehyde.
| Compound Name | 4-[4-[3-(dimethylamino)pyrrolidine-1-carbonyl]-5-fluoropyrimidin-2-yl]piperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 175378390 |
| Molecular Formula | C16H23FN6O2 |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | 4-[4-[3-(dimethylamino)pyrrolidine-1-carbonyl]-5-fluoropyrimidin-2-yl]piperazine-1-carbaldehyde |
| SMILES | CN(C)C1CCN(C(=O)c2nc(N3CCN(C=O)CC3)ncc2F)C1 |
| InChI | InChI=1S/C16H23FN6O2/c1-20(2)12-3-4-23(10-12)15(25)14-13(17)9-18-16(19-14)22-7-5-21(11-24)6-8-22/h9,11-12H,3-8,10H2,1-2H3 |
| InChIKey | GIVOADZNQWEZGL-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 72.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|