C21H21F3N2O2 — CID 162357915
1-[2-[4-[2-(4-methoxyphenyl)ethoxy]phenyl]ethyl]-3-(trifluoromethyl)pyrazole (PubChem CID 162357915) has the molecular formula C21H21F3N2O2 and a molecular weight of 390.41 g/mol. Its IUPAC name is 1-[2-[4-[2-(4-methoxyphenyl)ethoxy]phenyl]ethyl]-3-(trifluoromethyl)pyrazole.
| Compound Name | 1-[2-[4-[2-(4-methoxyphenyl)ethoxy]phenyl]ethyl]-3-(trifluoromethyl)pyrazole |
|---|---|
| PubChem CID | 162357915 |
| Molecular Formula | C21H21F3N2O2 |
| Molecular Weight | 390.41 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | 1-[2-[4-[2-(4-methoxyphenyl)ethoxy]phenyl]ethyl]-3-(trifluoromethyl)pyrazole |
| SMILES | COc1ccc(CCOc2ccc(CCn3ccc(C(F)(F)F)n3)cc2)cc1 |
| InChI | InChI=1S/C21H21F3N2O2/c1-27-18-6-2-17(3-7-18)12-15-28-19-8-4-16(5-9-19)10-13-26-14-11-20(25-26)21(22,23)24/h2-9,11,14H,10,12-13,15H2,1H3 |
| InChIKey | WHLUUZYVRVZXOF-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.41 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |