C15H16F3N5O2S — CID 9478874
1-[(4-methoxyphenyl)methyl]-3-[[2-[3-(trifluoromethyl)pyrazol-1-yl]acetyl]amino]thiourea (PubChem CID 9478874) has the molecular formula C15H16F3N5O2S and a molecular weight of 387.39 g/mol. Its IUPAC name is 1-[(4-methoxyphenyl)methyl]-3-[[2-[3-(trifluoromethyl)pyrazol-1-yl]acetyl]amino]thiourea.
| Compound Name | 1-[(4-methoxyphenyl)methyl]-3-[[2-[3-(trifluoromethyl)pyrazol-1-yl]acetyl]amino]thiourea |
|---|---|
| PubChem CID | 9478874 |
| Molecular Formula | C15H16F3N5O2S |
| Molecular Weight | 387.39 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | 1-[(4-methoxyphenyl)methyl]-3-[[2-[3-(trifluoromethyl)pyrazol-1-yl]acetyl]amino]thiourea |
| SMILES | COc1ccc(CNC(=S)NNC(=O)Cn2ccc(C(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C15H16F3N5O2S/c1-25-11-4-2-10(3-5-11)8-19-14(26)21-20-13(24)9-23-7-6-12(22-23)15(16,17)18/h2-7H,8-9H2,1H3,(H,20,24)(H2,19,21,26) |
| InChIKey | YKQOHOJOJVAOKJ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 80.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.39 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|