About 2-[3-acetyl-2-(2-methylbutanoyl)phenoxy]acetic acid;3-methylnonane-2,6-dione
2-[3-acetyl-2-(2-methylbutanoyl)phenoxy]acetic acid;3-methylnonane-2,6-dione (PubChem CID 162360629) has the molecular formula C25H36O7
and a molecular weight of 448.56 g/mol. Its IUPAC name is 2-[3-acetyl-2-(2-methylbutanoyl)phenoxy]acetic acid;3-methylnonane-2,6-dione.
Molecular Properties
| Compound Name | 2-[3-acetyl-2-(2-methylbutanoyl)phenoxy]acetic acid;3-methylnonane-2,6-dione |
| PubChem CID | 162360629 |
| Molecular Formula | C25H36O7 |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.25 |
| IUPAC Name | 2-[3-acetyl-2-(2-methylbutanoyl)phenoxy]acetic acid;3-methylnonane-2,6-dione |
| SMILES | CCC(C)C(=O)c1c(OCC(=O)O)cccc1C(C)=O.CCCC(=O)CCC(C)C(C)=O |
| InChI | InChI=1S/C15H18O5.C10H18O2/c1-4-9(2)15(19)14-11(10(3)16)6-5-7-12(14)20-8-13(17)18;1-4-5-10(12)7-6-8(2)9(3)11/h5-7,9H,4,8H2,1-3H3,(H,17,18);8H,4-7H2,1-3H3 |
| InChIKey | ARFODPYTHOOUNT-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 114.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[3-acetyl-2-(2-methylbutanoyl)phenoxy]acetic acid;3-methylnonane-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-acetyl-2-(2-methylbutanoyl)phenoxy]acetic acid;3-methylnonane-2,6-dione?
The IUPAC name of 2-[3-acetyl-2-(2-methylbutanoyl)phenoxy]acetic acid;3-methylnonane-2,6-dione (CID 162360629) is 2-[3-acetyl-2-(2-methylbutanoyl)phenoxy]acetic acid;3-methylnonane-2,6-dione.
What is the SMILES notation for 2-[3-acetyl-2-(2-methylbutanoyl)phenoxy]acetic acid;3-methylnonane-2,6-dione?
The canonical SMILES for 2-[3-acetyl-2-(2-methylbutanoyl)phenoxy]acetic acid;3-methylnonane-2,6-dione is CCC(C)C(=O)c1c(OCC(=O)O)cccc1C(C)=O.CCCC(=O)CCC(C)C(C)=O.
What is the InChIKey of 2-[3-acetyl-2-(2-methylbutanoyl)phenoxy]acetic acid;3-methylnonane-2,6-dione?
The InChIKey is ARFODPYTHOOUNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18O5.C10H18O2/c1-4-9(2)15(19)14-11(10(3)16)6-5-7-12(14)20-8-13(17)18;1-4-5-10(12)7-6-8(2)9(3)11/h5-7,9H,4,8H2,1-3H3,(H,17,18);8H,4-7H2,1-3H3.
What are the key properties of 2-[3-acetyl-2-(2-methylbutanoyl)phenoxy]acetic acid;3-methylnonane-2,6-dione?
2-[3-acetyl-2-(2-methylbutanoyl)phenoxy]acetic acid;3-methylnonane-2,6-dione has a molecular weight of 448.56 g/mol, XLogP of 4.94, 13 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-acetyl-2-(2-methylbutanoyl)phenoxy]acetic acid;3-methylnonane-2,6-dione is sourced from PubChem (CID 162360629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).