C30H51NO4 — CID 176967427
N-(2,3-diacetylphenyl)propanamide;ethane;7-ethenyl-8-methyldecan-4-one (PubChem CID 176967427) has the molecular formula C30H51NO4 and a molecular weight of 489.74 g/mol. Its IUPAC name is N-(2,3-diacetylphenyl)propanamide;ethane;7-ethenyl-8-methyldecan-4-one.
| Compound Name | N-(2,3-diacetylphenyl)propanamide;ethane;7-ethenyl-8-methyldecan-4-one |
|---|---|
| PubChem CID | 176967427 |
| Molecular Formula | C30H51NO4 |
| Molecular Weight | 489.74 g/mol |
| Exact Mass | 489.38 |
| IUPAC Name | N-(2,3-diacetylphenyl)propanamide;ethane;7-ethenyl-8-methyldecan-4-one |
| SMILES | C=CC(CCC(=O)CCC)C(C)CC.CC.CC.CCC(=O)Nc1cccc(C(C)=O)c1C(C)=O |
| InChI | InChI=1S/C13H15NO3.C13H24O.2C2H6/c1-4-12(17)14-11-7-5-6-10(8(2)15)13(11)9(3)16;1-5-8-13(14)10-9-12(7-3)11(4)6-2;2*1-2/h5-7H,4H2,1-3H3,(H,14,17);7,11-12H,3,5-6,8-10H2,1-2,4H3;2*1-2H3 |
| InChIKey | UOFQWCIHRPRBCC-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.74 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|