C25H38INO4 — CID 142517289
2-[3-acetyl-2-[(2R)-2-methylbutanoyl]phenoxy]-N-(6-iodo-3,3,5,5-tetramethylhexyl)acetamide (PubChem CID 142517289) has the molecular formula C25H38INO4 and a molecular weight of 543.49 g/mol. Its IUPAC name is 2-[3-acetyl-2-[(2R)-2-methylbutanoyl]phenoxy]-N-(6-iodo-3,3,5,5-tetramethylhexyl)acetamide.
| Compound Name | 2-[3-acetyl-2-[(2R)-2-methylbutanoyl]phenoxy]-N-(6-iodo-3,3,5,5-tetramethylhexyl)acetamide |
|---|---|
| PubChem CID | 142517289 |
| Molecular Formula | C25H38INO4 |
| Molecular Weight | 543.49 g/mol |
| Exact Mass | 543.18 |
| IUPAC Name | 2-[3-acetyl-2-[(2R)-2-methylbutanoyl]phenoxy]-N-(6-iodo-3,3,5,5-tetramethylhexyl)acetamide |
| SMILES | CC[C@@H](C)C(=O)c1c(OCC(=O)NCCC(C)(C)CC(C)(C)CI)cccc1C(C)=O |
| InChI | InChI=1S/C25H38INO4/c1-8-17(2)23(30)22-19(18(3)28)10-9-11-20(22)31-14-21(29)27-13-12-24(4,5)15-25(6,7)16-26/h9-11,17H,8,12-16H2,1-7H3,(H,27,29)/t17-/m1/s1 |
| InChIKey | MIBBXBWIAFASBP-QGZVFWFLSA-N |
| XLogP | 5.88 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.49 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|