C19H27F2N2O4PS — CID 162365255
(4,4-difluoropiperidin-1-yl)-[(3R)-1-(4-dimethylphosphorylphenyl)sulfonylpiperidin-3-yl]methanone (PubChem CID 162365255) has the molecular formula C19H27F2N2O4PS and a molecular weight of 448.47 g/mol. Its IUPAC name is (4,4-difluoropiperidin-1-yl)-[(3R)-1-(4-dimethylphosphorylphenyl)sulfonylpiperidin-3-yl]methanone.
| Compound Name | (4,4-difluoropiperidin-1-yl)-[(3R)-1-(4-dimethylphosphorylphenyl)sulfonylpiperidin-3-yl]methanone |
|---|---|
| PubChem CID | 162365255 |
| Molecular Formula | C19H27F2N2O4PS |
| Molecular Weight | 448.47 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | (4,4-difluoropiperidin-1-yl)-[(3R)-1-(4-dimethylphosphorylphenyl)sulfonylpiperidin-3-yl]methanone |
| SMILES | CP(C)(=O)c1ccc(S(=O)(=O)N2CCC[C@@H](C(=O)N3CCC(F)(F)CC3)C2)cc1 |
| InChI | InChI=1S/C19H27F2N2O4PS/c1-28(2,25)16-5-7-17(8-6-16)29(26,27)23-11-3-4-15(14-23)18(24)22-12-9-19(20,21)10-13-22/h5-8,15H,3-4,9-14H2,1-2H3/t15-/m1/s1 |
| InChIKey | XFCPDMOQQLVDNZ-OAHLLOKOSA-N |
| XLogP | 2.59 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.47 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|