C26H42N4O8 — CID 162368130
bis[2-[(2-methylpropan-2-yl)oxycarbonyl]-2,7-diazaspiro[4.4]nonan-1-yl] oxalate (PubChem CID 162368130) has the molecular formula C26H42N4O8 and a molecular weight of 538.64 g/mol. Its IUPAC name is bis[2-[(2-methylpropan-2-yl)oxycarbonyl]-2,7-diazaspiro[4.4]nonan-1-yl] oxalate.
| Compound Name | bis[2-[(2-methylpropan-2-yl)oxycarbonyl]-2,7-diazaspiro[4.4]nonan-1-yl] oxalate |
|---|---|
| PubChem CID | 162368130 |
| Molecular Formula | C26H42N4O8 |
| Molecular Weight | 538.64 g/mol |
| Exact Mass | 538.30 |
| IUPAC Name | bis[2-[(2-methylpropan-2-yl)oxycarbonyl]-2,7-diazaspiro[4.4]nonan-1-yl] oxalate |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CCNC2)C1OC(=O)C(=O)OC1N(C(=O)OC(C)(C)C)CCC12CCNC2 |
| InChI | InChI=1S/C26H42N4O8/c1-23(2,3)37-21(33)29-13-9-25(7-11-27-15-25)19(29)35-17(31)18(32)36-20-26(8-12-28-16-26)10-14-30(20)22(34)38-24(4,5)6/h19-20,27-28H,7-16H2,1-6H3 |
| InChIKey | WVTGNOZQEZJZPV-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 135.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.64 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|