C13H23FN2O2 — CID 71305847
tert-butyl 10-fluoro-2,7-diazaspiro[4.5]decane-7-carboxylate (PubChem CID 71305847) has the molecular formula C13H23FN2O2 and a molecular weight of 258.34 g/mol. Its IUPAC name is tert-butyl 10-fluoro-2,7-diazaspiro[4.5]decane-7-carboxylate.
| Compound Name | tert-butyl 10-fluoro-2,7-diazaspiro[4.5]decane-7-carboxylate |
|---|---|
| PubChem CID | 71305847 |
| Molecular Formula | C13H23FN2O2 |
| Molecular Weight | 258.34 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | tert-butyl 10-fluoro-2,7-diazaspiro[4.5]decane-7-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(F)C2(CCNC2)C1 |
| InChI | InChI=1S/C13H23FN2O2/c1-12(2,3)18-11(17)16-7-4-10(14)13(9-16)5-6-15-8-13/h10,15H,4-9H2,1-3H3 |
| InChIKey | MYRFQFLASPKFQB-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.34 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |