C12H22F2N2O2 — CID 138987888
tert-butyl 3,3-difluoro-1,5-diazonane-1-carboxylate (PubChem CID 138987888) has the molecular formula C12H22F2N2O2 and a molecular weight of 264.32 g/mol. Its IUPAC name is tert-butyl 3,3-difluoro-1,5-diazonane-1-carboxylate.
| Compound Name | tert-butyl 3,3-difluoro-1,5-diazonane-1-carboxylate |
|---|---|
| PubChem CID | 138987888 |
| Molecular Formula | C12H22F2N2O2 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | tert-butyl 3,3-difluoro-1,5-diazonane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCCNCC(F)(F)C1 |
| InChI | InChI=1S/C12H22F2N2O2/c1-11(2,3)18-10(17)16-7-5-4-6-15-8-12(13,14)9-16/h15H,4-9H2,1-3H3 |
| InChIKey | ITRIBVSQLQJTDR-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |