C14H16Br2N4O2 — CID 162373977
N-[1,1-dibromo-2-[1-(2-hydroxyethyl)triazol-4-yl]propan-2-yl]benzamide (PubChem CID 162373977) has the molecular formula C14H16Br2N4O2 and a molecular weight of 432.12 g/mol. Its IUPAC name is N-[1,1-dibromo-2-[1-(2-hydroxyethyl)triazol-4-yl]propan-2-yl]benzamide.
| Compound Name | N-[1,1-dibromo-2-[1-(2-hydroxyethyl)triazol-4-yl]propan-2-yl]benzamide |
|---|---|
| PubChem CID | 162373977 |
| Molecular Formula | C14H16Br2N4O2 |
| Molecular Weight | 432.12 g/mol |
| Exact Mass | 429.96 |
| IUPAC Name | N-[1,1-dibromo-2-[1-(2-hydroxyethyl)triazol-4-yl]propan-2-yl]benzamide |
| SMILES | CC(NC(=O)c1ccccc1)(c1cn(CCO)nn1)C(Br)Br |
| InChI | InChI=1S/C14H16Br2N4O2/c1-14(13(15)16,11-9-20(7-8-21)19-18-11)17-12(22)10-5-3-2-4-6-10/h2-6,9,13,21H,7-8H2,1H3,(H,17,22) |
| InChIKey | HWAQCYIWQVCVNB-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.12 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|