C15H18Cl2N4O4S — CID 154687728
2-[4-[2-[(3,4-dichlorobenzoyl)amino]propan-2-yl]triazol-1-yl]ethyl methanesulfonate (PubChem CID 154687728) has the molecular formula C15H18Cl2N4O4S and a molecular weight of 421.31 g/mol. Its IUPAC name is 2-[4-[2-[(3,4-dichlorobenzoyl)amino]propan-2-yl]triazol-1-yl]ethyl methanesulfonate.
| Compound Name | 2-[4-[2-[(3,4-dichlorobenzoyl)amino]propan-2-yl]triazol-1-yl]ethyl methanesulfonate |
|---|---|
| PubChem CID | 154687728 |
| Molecular Formula | C15H18Cl2N4O4S |
| Molecular Weight | 421.31 g/mol |
| Exact Mass | 420.04 |
| IUPAC Name | 2-[4-[2-[(3,4-dichlorobenzoyl)amino]propan-2-yl]triazol-1-yl]ethyl methanesulfonate |
| SMILES | CC(C)(NC(=O)c1ccc(Cl)c(Cl)c1)c1cn(CCOS(C)(=O)=O)nn1 |
| InChI | InChI=1S/C15H18Cl2N4O4S/c1-15(2,18-14(22)10-4-5-11(16)12(17)8-10)13-9-21(20-19-13)6-7-25-26(3,23)24/h4-5,8-9H,6-7H2,1-3H3,(H,18,22) |
| InChIKey | LHFLVKFMLHIKPF-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 103.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.31 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|